Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Furfuryl Alcohol, 98%
CAS: 98-00-0 Molecular Formula: C5H6O2 Molecular Weight (g/mol): 98.1 MDL Number: MFCD00003252 InChI Key: XPFVYQJUAUNWIW-UHFFFAOYSA-N Synonym: furfuryl alcohol,2-furanmethanol,2-furylmethanol,2-furancarbinol,2-furylcarbinol,furfuranol,2-furanylmethanol,furfural alcohol,2-furfuryl alcohol,5-hydroxymethylfuran PubChem CID: 7361 ChEBI: CHEBI:207496 IUPAC Name: furan-2-ylmethanol SMILES: C1=COC(=C1)CO
| PubChem CID | 7361 |
|---|---|
| CAS | 98-00-0 |
| Molecular Weight (g/mol) | 98.1 |
| ChEBI | CHEBI:207496 |
| MDL Number | MFCD00003252 |
| SMILES | C1=COC(=C1)CO |
| Synonym | furfuryl alcohol,2-furanmethanol,2-furylmethanol,2-furancarbinol,2-furylcarbinol,furfuranol,2-furanylmethanol,furfural alcohol,2-furfuryl alcohol,5-hydroxymethylfuran |
| IUPAC Name | furan-2-ylmethanol |
| InChI Key | XPFVYQJUAUNWIW-UHFFFAOYSA-N |
| Molecular Formula | C5H6O2 |
Tenofovir disoproxil fumarate, 98%, Thermo Scientific Chemicals
CAS: 202138-50-9 Molecular Formula: C19H30N5O10P·C4H4O4 Molecular Weight (g/mol): 635.51 InChI Key: VCMJCVGFSROFHV-WZGZYPNHSA-N Synonym: tenofovir disoproxil fumarate,viread,tenofovir df,unii-ott9j7900i,tenofovir disoproxil fumarate usan,9-r-2-bis isopropoxycarbonyl oxy methoxy phosphinyl methoxy propyl adenine fumarate,9-r-2-bis isopropoxycarbonyl oxy methoxy phosphinyl methoxy propyl adenine, fumarate,r-5-2-6-amino-9h-purin-9-yl-1-methylethoxy methyl-2,4,6,8-tetraoxa-5-phosphanonanedioic acid, bis 1-methylethyl ester, 5-oxide, e-2-butenedioate 1:1,9-r-2-bis isopropoxycarbonyl oxy methoxy phosphinyl methoxy propyl adenine fumarate 1:1 PubChem CID: 6398764 ChEBI: CHEBI:63718 IUPAC Name: [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate;(E)-but-2-enedioic acid SMILES: CC(C)OC(=O)OCOP(=O)(COC(C)CN1C=NC2=C1N=CN=C2N)OCOC(=O)OC(C)C.C(=CC(=O)O)C(=O)O
| PubChem CID | 6398764 |
|---|---|
| CAS | 202138-50-9 |
| Molecular Weight (g/mol) | 635.51 |
| ChEBI | CHEBI:63718 |
| SMILES | CC(C)OC(=O)OCOP(=O)(COC(C)CN1C=NC2=C1N=CN=C2N)OCOC(=O)OC(C)C.C(=CC(=O)O)C(=O)O |
| Synonym | tenofovir disoproxil fumarate,viread,tenofovir df,unii-ott9j7900i,tenofovir disoproxil fumarate usan,9-r-2-bis isopropoxycarbonyl oxy methoxy phosphinyl methoxy propyl adenine fumarate,9-r-2-bis isopropoxycarbonyl oxy methoxy phosphinyl methoxy propyl adenine, fumarate,r-5-2-6-amino-9h-purin-9-yl-1-methylethoxy methyl-2,4,6,8-tetraoxa-5-phosphanonanedioic acid, bis 1-methylethyl ester, 5-oxide, e-2-butenedioate 1:1,9-r-2-bis isopropoxycarbonyl oxy methoxy phosphinyl methoxy propyl adenine fumarate 1:1 |
| IUPAC Name | [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate;(E)-but-2-enedioic acid |
| InChI Key | VCMJCVGFSROFHV-WZGZYPNHSA-N |
| Molecular Formula | C19H30N5O10P·C4H4O4 |
Triethylamine trihydrofluoride, ca. 37% HF
CAS: 73602-61-6 Molecular Formula: C6H15N·3HF Molecular Weight (g/mol): 161.21 MDL Number: MFCD00043294 InChI Key: IKGLACJFEHSFNN-UHFFFAOYSA-N Synonym: triethylamine trihydrofluoride,n,n-diethylethanamine trihydrofluoride,triethylammonium fluoride,ethanamine, n,n-diethyl-, trihydrofluoride,triethylamine trishydrofluoride,hydrogen fluoride in triethylamine,hf in triethylamine,triethylaminetrihydrofluoride,hydrogen fluoride triethylamine,ethanamine, n,n-diethyl-, hydrofluoride 1:3 PubChem CID: 175505 IUPAC Name: N,N-diethylethanamine;trihydrofluoride SMILES: CCN(CC)CC.F.F.F
| PubChem CID | 175505 |
|---|---|
| CAS | 73602-61-6 |
| Molecular Weight (g/mol) | 161.21 |
| MDL Number | MFCD00043294 |
| SMILES | CCN(CC)CC.F.F.F |
| Synonym | triethylamine trihydrofluoride,n,n-diethylethanamine trihydrofluoride,triethylammonium fluoride,ethanamine, n,n-diethyl-, trihydrofluoride,triethylamine trishydrofluoride,hydrogen fluoride in triethylamine,hf in triethylamine,triethylaminetrihydrofluoride,hydrogen fluoride triethylamine,ethanamine, n,n-diethyl-, hydrofluoride 1:3 |
| IUPAC Name | N,N-diethylethanamine;trihydrofluoride |
| InChI Key | IKGLACJFEHSFNN-UHFFFAOYSA-N |
| Molecular Formula | C6H15N·3HF |
Triethylamine, 99.5%, for analysis
CAS: 121-44-8 Molecular Formula: C6H15N Molecular Weight (g/mol): 101.19 InChI Key: ZMANZCXQSJIPKH-UHFFFAOYSA-N Synonym: triethylamine,ethanamine, n,n-diethyl,diethylamino ethane,triaethylamin,triethylamin,trietilamina,triethyl amine,n,n,n-triethylamine,net3,diethylaminoethane PubChem CID: 8471 ChEBI: CHEBI:35026 IUPAC Name: N,N-diethylethanamine SMILES: CCN(CC)CC
| PubChem CID | 8471 |
|---|---|
| CAS | 121-44-8 |
| Molecular Weight (g/mol) | 101.19 |
| ChEBI | CHEBI:35026 |
| SMILES | CCN(CC)CC |
| Synonym | triethylamine,ethanamine, n,n-diethyl,diethylamino ethane,triaethylamin,triethylamin,trietilamina,triethyl amine,n,n,n-triethylamine,net3,diethylaminoethane |
| IUPAC Name | N,N-diethylethanamine |
| InChI Key | ZMANZCXQSJIPKH-UHFFFAOYSA-N |
| Molecular Formula | C6H15N |
o-Dianisidine, 98+%
CAS: 119-90-4 Molecular Formula: C14H16N2O2 Molecular Weight (g/mol): 244.294 MDL Number: MFCD00008372 InChI Key: JRBJSXQPQWSCCF-UHFFFAOYSA-N Synonym: 3,3'-dimethoxybenzidine,o-dianisidine,dianisidine,cellitazol b,neutrosel navy bn,diacel navy dc,disperse black 6,blue base nb,blue bn base,blue base irga b PubChem CID: 8411 ChEBI: CHEBI:82321 IUPAC Name: 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline SMILES: COC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)OC)N
| PubChem CID | 8411 |
|---|---|
| CAS | 119-90-4 |
| Molecular Weight (g/mol) | 244.294 |
| ChEBI | CHEBI:82321 |
| MDL Number | MFCD00008372 |
| SMILES | COC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)OC)N |
| Synonym | 3,3'-dimethoxybenzidine,o-dianisidine,dianisidine,cellitazol b,neutrosel navy bn,diacel navy dc,disperse black 6,blue base nb,blue bn base,blue base irga b |
| IUPAC Name | 4-(4-amino-3-methoxyphenyl)-2-methoxyaniline |
| InChI Key | JRBJSXQPQWSCCF-UHFFFAOYSA-N |
| Molecular Formula | C14H16N2O2 |
Methanesulfonyl chloride, 99.5%
CAS: 124-63-0 Molecular Formula: CH3ClO2S Molecular Weight (g/mol): 114.54 MDL Number: MFCD00007454 InChI Key: QARBMVPHQWIHKH-UHFFFAOYSA-N Synonym: mesyl chloride,methylsulfonyl chloride,methyl sulfochloride,methanesulphonyl chloride,chloro methyl sulfone,methanesulfuryl chloride,methanesulfonic acid chloride,methyl sulfonyl chloride,chloromethyl sulfone,mesylchloride PubChem CID: 31297 IUPAC Name: methanesulfonyl chloride SMILES: CS(Cl)(=O)=O
| PubChem CID | 31297 |
|---|---|
| CAS | 124-63-0 |
| Molecular Weight (g/mol) | 114.54 |
| MDL Number | MFCD00007454 |
| SMILES | CS(Cl)(=O)=O |
| Synonym | mesyl chloride,methylsulfonyl chloride,methyl sulfochloride,methanesulphonyl chloride,chloro methyl sulfone,methanesulfuryl chloride,methanesulfonic acid chloride,methyl sulfonyl chloride,chloromethyl sulfone,mesylchloride |
| IUPAC Name | methanesulfonyl chloride |
| InChI Key | QARBMVPHQWIHKH-UHFFFAOYSA-N |
| Molecular Formula | CH3ClO2S |
Caffeic Acid 98.0+%, TCI America™
CAS: 331-39-5 Molecular Formula: C9H8O4 Molecular Weight (g/mol): 180.159 MDL Number: MFCD00004392 InChI Key: QAIPRVGONGVQAS-DUXPYHPUSA-N Synonym: caffeic acid,3,4-dihydroxycinnamic acid,3-3,4-dihydroxyphenyl acrylic acid,trans-caffeate,3,4-dihydroxy-trans-cinnamate,2e-3-3,4-dihydroxyphenyl prop-2-enoic acid,3,4-dihydroxybenzeneacrylic acid,e-3-3,4-dihydroxyphenyl acrylic acid,trans-caffeic acid,3-3,4-dihydroxyphenyl propenoic acid PubChem CID: 689043 ChEBI: CHEBI:16433 IUPAC Name: (E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid SMILES: C1=CC(=C(C=C1C=CC(=O)O)O)O
| PubChem CID | 689043 |
|---|---|
| CAS | 331-39-5 |
| Molecular Weight (g/mol) | 180.159 |
| ChEBI | CHEBI:16433 |
| MDL Number | MFCD00004392 |
| SMILES | C1=CC(=C(C=C1C=CC(=O)O)O)O |
| Synonym | caffeic acid,3,4-dihydroxycinnamic acid,3-3,4-dihydroxyphenyl acrylic acid,trans-caffeate,3,4-dihydroxy-trans-cinnamate,2e-3-3,4-dihydroxyphenyl prop-2-enoic acid,3,4-dihydroxybenzeneacrylic acid,e-3-3,4-dihydroxyphenyl acrylic acid,trans-caffeic acid,3-3,4-dihydroxyphenyl propenoic acid |
| IUPAC Name | (E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid |
| InChI Key | QAIPRVGONGVQAS-DUXPYHPUSA-N |
| Molecular Formula | C9H8O4 |
Hydrindantin dihydrate, 96%
CAS: 5950-69-6 Molecular Formula: C18H14O8 Molecular Weight (g/mol): 358.29 MDL Number: MFCD00149242 InChI Key: QHVADKNWNMILPQ-HOTGVXAUSA-N Synonym: 2s-2,3,3-trihydroxy-2-2s-1,1,2-trihydroxy-3-oxoinden-2-yl inden-1-one PubChem CID: 6560392 IUPAC Name: (2S)-2,3,3-trihydroxy-2-[(2S)-1,1,2-trihydroxy-3-oxoinden-2-yl]inden-1-one SMILES: C1=CC=C2C(=C1)C(=O)C(C2(O)O)(C3(C(=O)C4=CC=CC=C4C3(O)O)O)O
| PubChem CID | 6560392 |
|---|---|
| CAS | 5950-69-6 |
| Molecular Weight (g/mol) | 358.29 |
| MDL Number | MFCD00149242 |
| SMILES | C1=CC=C2C(=C1)C(=O)C(C2(O)O)(C3(C(=O)C4=CC=CC=C4C3(O)O)O)O |
| Synonym | 2s-2,3,3-trihydroxy-2-2s-1,1,2-trihydroxy-3-oxoinden-2-yl inden-1-one |
| IUPAC Name | (2S)-2,3,3-trihydroxy-2-[(2S)-1,1,2-trihydroxy-3-oxoinden-2-yl]inden-1-one |
| InChI Key | QHVADKNWNMILPQ-HOTGVXAUSA-N |
| Molecular Formula | C18H14O8 |
Ethanethiol, 99+%
CAS: 75-08-1 Molecular Formula: C2H6S Molecular Weight (g/mol): 62.13 MDL Number: MFCD00004887 InChI Key: DNJIEGIFACGWOD-UHFFFAOYSA-N Synonym: ethyl mercaptan,mercaptoethane,thioethanol,ethyl hydrosulfide,ethyl sulfhydrate,ethyl thioalcohol,thioethyl alcohol,1-mercaptoethane,aethanethiol,aethylmercaptan PubChem CID: 6343 IUPAC Name: ethanethiol SMILES: CCS
| PubChem CID | 6343 |
|---|---|
| CAS | 75-08-1 |
| Molecular Weight (g/mol) | 62.13 |
| MDL Number | MFCD00004887 |
| SMILES | CCS |
| Synonym | ethyl mercaptan,mercaptoethane,thioethanol,ethyl hydrosulfide,ethyl sulfhydrate,ethyl thioalcohol,thioethyl alcohol,1-mercaptoethane,aethanethiol,aethylmercaptan |
| IUPAC Name | ethanethiol |
| InChI Key | DNJIEGIFACGWOD-UHFFFAOYSA-N |
| Molecular Formula | C2H6S |
2,2-Bis(hydroxymethyl)-2,2',2″-nitrilotriethanol, 99+%
CAS: 6976-37-0 Molecular Formula: C8H19NO5 Molecular Weight (g/mol): 209.24 MDL Number: MFCD00002853 InChI Key: OWMVSZAMULFTJU-UHFFFAOYSA-N Synonym: bis-tris,bistris,2,2-bis hydroxymethyl-2,2',2-nitrilotriethanol,bis 2-hydroxyethyl aminotris hydroxymethyl methane,bis-tris buffer,1,3-propanediol, 2-bis 2-hydroxyethyl amino-2-hydroxymethyl,unii-q1xc3631cp,bis 2-hydroxyethyl amino-tris hydroxymethyl methane,2-bis 2-hydroxyethyl amino-2-hydroxymethyl propane-1,3-diol,bis 2-hydroxyethyl iminotris hydroxymethyl methane PubChem CID: 81462 ChEBI: CHEBI:41250 IUPAC Name: 2-[bis(2-hydroxyethyl)amino]-2-(hydroxymethyl)propane-1,3-diol SMILES: C(CO)N(CCO)C(CO)(CO)CO
| PubChem CID | 81462 |
|---|---|
| CAS | 6976-37-0 |
| Molecular Weight (g/mol) | 209.24 |
| ChEBI | CHEBI:41250 |
| MDL Number | MFCD00002853 |
| SMILES | C(CO)N(CCO)C(CO)(CO)CO |
| Synonym | bis-tris,bistris,2,2-bis hydroxymethyl-2,2',2-nitrilotriethanol,bis 2-hydroxyethyl aminotris hydroxymethyl methane,bis-tris buffer,1,3-propanediol, 2-bis 2-hydroxyethyl amino-2-hydroxymethyl,unii-q1xc3631cp,bis 2-hydroxyethyl amino-tris hydroxymethyl methane,2-bis 2-hydroxyethyl amino-2-hydroxymethyl propane-1,3-diol,bis 2-hydroxyethyl iminotris hydroxymethyl methane |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]-2-(hydroxymethyl)propane-1,3-diol |
| InChI Key | OWMVSZAMULFTJU-UHFFFAOYSA-N |
| Molecular Formula | C8H19NO5 |
Benzyl alcohol, ACS reagent
CAS: 100-51-6 Molecular Formula: C7H8O Molecular Weight (g/mol): 108.14 MDL Number: MFCD00004599,MFCD03792087 InChI Key: WVDDGKGOMKODPV-UHFFFAOYSA-N Synonym: benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol PubChem CID: 244 ChEBI: CHEBI:17987 IUPAC Name: phenylmethanol SMILES: OCC1=CC=CC=C1
| PubChem CID | 244 |
|---|---|
| CAS | 100-51-6 |
| Molecular Weight (g/mol) | 108.14 |
| ChEBI | CHEBI:17987 |
| MDL Number | MFCD00004599,MFCD03792087 |
| SMILES | OCC1=CC=CC=C1 |
| Synonym | benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol |
| IUPAC Name | phenylmethanol |
| InChI Key | WVDDGKGOMKODPV-UHFFFAOYSA-N |
| Molecular Formula | C7H8O |
Thermo Scientific Chemicals 5-Sulfosalicylic acid dihydrate, 99+%
CAS: 5965-83-3 | C9H14O6S | 250.27 g/mol
| Molecular Weight (g/mol) | 250.27 |
|---|---|
| CAS Min % | 99.0 |
| InChI Key | NFYHZVWMQHQKRU-UHFFFAOYSA-N |
| PubChem CID | 2723734 |
| Name Note | p.a. |
| Percent Purity | 99+% |
| Fieser | 01,1118 |
| Infrared Spectrum | Authentic |
| Formula Weight | 254.22 |
| Melting Point | 106.0°C to 110.0°C |
| CAS Max % | 100.0 |
| Color | White |
| Physical Form | Crystalline Powder |
| Chemical Name or Material | 5-Sulfosalicylic acid dihydrate |
| SMILES | C.C.OC(=O)C1=CC(=CC=C1O)S(O)(=O)=O |
| Merck Index | 15, 9094 |
| Assay Percent Range | 99+% |
| CAS | 97-05-2 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if pre |
| MDL Number | MFCD00007508,MFCD00149540 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if swallowed. |
| Solubility Information | Solubility in water: 127g/L (20°C). Other solubilities: soluble in alcohol and ether |
| Packaging | Plastic bottle |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | 2-hydroxy-5-sulfobenzoic acid dihydrate,5-sulfosalicylic acid dihydrate,sulfosalicylic acid dihydrate,benzoic acid, 2-hydroxy-5-sulfo-, dihydrate,unii-09ngq462s6,2-hydroxy-5-sulfobenzoic acid, hydrate, hydrate,5-sulfosalicylsyre,5-sulfosalicylsaeure,salicylic acid, 5-sulfo-, dihydrate,acmc-1aymd |
| Beilstein | 11, 411 |
| Molecular Formula | C9H14O6S |
Methyl p-toluenesulfonate, 97%
CAS: 80-48-8 Molecular Formula: C8H10O3S Molecular Weight (g/mol): 186.23 MDL Number: MFCD00008417 InChI Key: VUQUOGPMUUJORT-UHFFFAOYSA-N Synonym: methyl p-toluenesulfonate,methyl tosylate,methyl p-tosylate,methyl toluene-4-sulfonate,methyl-p-toluenesulfonate,p-toluenesulfonic acid, methyl ester,benzenesulfonic acid, 4-methyl-, methyl ester,methyl toluene-4-sulphonate,p-toluenesulfonic acid methyl ester,p-methylbenzenesulfonate methyl ester PubChem CID: 6645 IUPAC Name: methyl 4-methylbenzenesulfonate SMILES: CC1=CC=C(C=C1)S(=O)(=O)OC
| PubChem CID | 6645 |
|---|---|
| CAS | 80-48-8 |
| Molecular Weight (g/mol) | 186.23 |
| MDL Number | MFCD00008417 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC |
| Synonym | methyl p-toluenesulfonate,methyl tosylate,methyl p-tosylate,methyl toluene-4-sulfonate,methyl-p-toluenesulfonate,p-toluenesulfonic acid, methyl ester,benzenesulfonic acid, 4-methyl-, methyl ester,methyl toluene-4-sulphonate,p-toluenesulfonic acid methyl ester,p-methylbenzenesulfonate methyl ester |
| IUPAC Name | methyl 4-methylbenzenesulfonate |
| InChI Key | VUQUOGPMUUJORT-UHFFFAOYSA-N |
| Molecular Formula | C8H10O3S |
DETA NONOate, 95%
CAS: 146724-94-9 Molecular Formula: C4H13N5O2 Molecular Weight (g/mol): 163.2 MDL Number: MFCD00278808 InChI Key: HMRRJTFDJAVRMR-UHFFFAOYSA-N Synonym: deta nonoate,noc-18,deta-nonoate,diethylenetriamine nonoate,2,2'-hydroxynitrosohydrazino bis-ethanamine,aeed/no,1,1-bis 2-aminoethyl-2-hydroxy-3-oxotriazane,3,3-bis aminoethyl-1-hydroxy-2-oxo-1-triazene,detanonoate,1-hydroxy-2-oxo-3,3-bis 3-aminoethyl-1-triazene PubChem CID: 1606 ChEBI: CHEBI:50154 IUPAC Name: N-[bis(2-aminoethyl)amino]-N-hydroxynitrous amide SMILES: C(CN(CCN)N(N=O)O)N
| PubChem CID | 1606 |
|---|---|
| CAS | 146724-94-9 |
| Molecular Weight (g/mol) | 163.2 |
| ChEBI | CHEBI:50154 |
| MDL Number | MFCD00278808 |
| SMILES | C(CN(CCN)N(N=O)O)N |
| Synonym | deta nonoate,noc-18,deta-nonoate,diethylenetriamine nonoate,2,2'-hydroxynitrosohydrazino bis-ethanamine,aeed/no,1,1-bis 2-aminoethyl-2-hydroxy-3-oxotriazane,3,3-bis aminoethyl-1-hydroxy-2-oxo-1-triazene,detanonoate,1-hydroxy-2-oxo-3,3-bis 3-aminoethyl-1-triazene |
| IUPAC Name | N-[bis(2-aminoethyl)amino]-N-hydroxynitrous amide |
| InChI Key | HMRRJTFDJAVRMR-UHFFFAOYSA-N |
| Molecular Formula | C4H13N5O2 |
Toluene, 99.85%, Extra Dry, AcroSeal™
CAS: 108-88-3 Molecular Formula: C7H8 Molecular Weight (g/mol): 92.14 MDL Number: MFCD00008512 InChI Key: YXFVVABEGXRONW-UHFFFAOYSA-N Synonym: methylbenzene,toluol,phenylmethane,benzene, methyl,methylbenzol,methacide,toluen,antisal 1a,tolu-sol,monomethyl benzene PubChem CID: 1140 ChEBI: CHEBI:17578 IUPAC Name: toluene SMILES: CC1=CC=CC=C1
| PubChem CID | 1140 |
|---|---|
| CAS | 108-88-3 |
| Molecular Weight (g/mol) | 92.14 |
| ChEBI | CHEBI:17578 |
| MDL Number | MFCD00008512 |
| SMILES | CC1=CC=CC=C1 |
| Synonym | methylbenzene,toluol,phenylmethane,benzene, methyl,methylbenzol,methacide,toluen,antisal 1a,tolu-sol,monomethyl benzene |
| IUPAC Name | toluene |
| InChI Key | YXFVVABEGXRONW-UHFFFAOYSA-N |
| Molecular Formula | C7H8 |